C17H20ClF3N4O — CID 59715496
(2S)-2-[[(1S)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-4-methylpentanamide (PubChem CID 59715496) has the molecular formula C17H20ClF3N4O and a molecular weight of 388.82 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[(1S)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 59715496 |
| Molecular Formula | C17H20ClF3N4O |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (2S)-2-[[(1S)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl]amino]-N-(1-cyanocyclopropyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(Cl)nc1)C(F)(F)F)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C17H20ClF3N4O/c1-10(2)7-12(15(26)25-16(9-22)5-6-16)24-14(17(19,20)21)11-3-4-13(18)23-8-11/h3-4,8,10,12,14,24H,5-7H2,1-2H3,(H,25,26)/t12-,14-/m0/s1 |
| InChIKey | VIEQELXSGCPUDY-JSGCOSHPSA-N |
| XLogP | 3.52 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|