C28H14Br2N4 — CID 59715567
4,13-bis(4-bromophenyl)-3,5,12,14-tetrazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene (PubChem CID 59715567) has the molecular formula C28H14Br2N4 and a molecular weight of 566.26 g/mol. Its IUPAC name is 4,13-bis(4-bromophenyl)-3,5,12,14-tetrazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene.
| Compound Name | 4,13-bis(4-bromophenyl)-3,5,12,14-tetrazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene |
|---|---|
| PubChem CID | 59715567 |
| Molecular Formula | C28H14Br2N4 |
| Molecular Weight | 566.26 g/mol |
| Exact Mass | 563.96 |
| IUPAC Name | 4,13-bis(4-bromophenyl)-3,5,12,14-tetrazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene |
| SMILES | Brc1ccc(-c2nc3cccc4c5nc(-c6ccc(Br)cc6)nc6cccc(c(n2)c34)c65)cc1 |
| InChI | InChI=1S/C28H14Br2N4/c29-17-11-7-15(8-12-17)27-31-21-5-1-3-19-23(21)26(34-27)20-4-2-6-22-24(20)25(19)33-28(32-22)16-9-13-18(30)14-10-16/h1-14H |
| InChIKey | URQGPOBJLIWJOJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.26 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|