About [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate
[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate (PubChem CID 59715600) has the molecular formula C15H10F3NO3S2
and a molecular weight of 373.38 g/mol. Its IUPAC name is [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 59715600 |
| Molecular Formula | C15H10F3NO3S2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cc2nccc3sccc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H10F3NO3S2/c16-15(17,18)24(20,21)22-11-3-1-10(2-4-11)9-13-12-6-8-23-14(12)5-7-19-13/h1-8H,9H2 |
| InChIKey | SEWGLHLBEZJFKV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate (CID 59715600) is [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(Cc2nccc3sccc23)cc1)C(F)(F)F.
What is the InChIKey of [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate?
The InChIKey is SEWGLHLBEZJFKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3NO3S2/c16-15(17,18)24(20,21)22-11-3-1-10(2-4-11)9-13-12-6-8-23-14(12)5-7-19-13/h1-8H,9H2.
What are the key properties of [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate?
[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate has a molecular weight of 373.38 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 59715600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).