About azanide;4,4-dimethylpiperidin-1-ide;yttrium
azanide;4,4-dimethylpiperidin-1-ide;yttrium (PubChem CID 59715907) has the molecular formula C7H16N2Y-2
and a molecular weight of 217.12 g/mol. Its IUPAC name is azanide;4,4-dimethylpiperidin-1-ide;yttrium.
Molecular Properties
| Compound Name | azanide;4,4-dimethylpiperidin-1-ide;yttrium |
|---|
| PubChem CID | 59715907 |
|---|
| Molecular Formula | C7H16N2Y-2 |
|---|
| Molecular Weight | 217.12 g/mol |
|---|
| Exact Mass | 217.04 |
|---|
| IUPAC Name | azanide;4,4-dimethylpiperidin-1-ide;yttrium |
|---|
| SMILES | CC1(C)CC[N-]CC1.[NH2-].[Y] |
|---|
| InChI | InChI=1S/C7H14N.H2N.Y/c1-7(2)3-5-8-6-4-7;;/h3-6H2,1-2H3;1H2;/q2*-1; |
|---|
| InChIKey | CKMVNMGRJQWWQB-UHFFFAOYSA-N |
|---|
| XLogP | 2.89 |
|---|
| TPSA | 47.60 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze azanide;4,4-dimethylpiperidin-1-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;4,4-dimethylpiperidin-1-ide;yttrium?
The IUPAC name of azanide;4,4-dimethylpiperidin-1-ide;yttrium (CID 59715907) is azanide;4,4-dimethylpiperidin-1-ide;yttrium.
What is the SMILES notation for azanide;4,4-dimethylpiperidin-1-ide;yttrium?
The canonical SMILES for azanide;4,4-dimethylpiperidin-1-ide;yttrium is CC1(C)CC[N-]CC1.[NH2-].[Y].
What is the InChIKey of azanide;4,4-dimethylpiperidin-1-ide;yttrium?
The InChIKey is CKMVNMGRJQWWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N.H2N.Y/c1-7(2)3-5-8-6-4-7;;/h3-6H2,1-2H3;1H2;/q2*-1;.
What are the key properties of azanide;4,4-dimethylpiperidin-1-ide;yttrium?
azanide;4,4-dimethylpiperidin-1-ide;yttrium has a molecular weight of 217.12 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;4,4-dimethylpiperidin-1-ide;yttrium is sourced from PubChem (CID 59715907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).