About CID 59716380
CID 59716380 (PubChem CID 59716380) has the molecular formula C6H4BrN
and a molecular weight of 170.01 g/mol.
Molecular Properties
| Compound Name | CID 59716380 |
| PubChem CID | 59716380 |
| Molecular Formula | C6H4BrN |
| Molecular Weight | 170.01 g/mol |
| Exact Mass | 168.95 |
| IUPAC Name | — |
| SMILES | [CH]c1cccc(Br)n1 |
| InChI | InChI=1S/C6H4BrN/c1-5-3-2-4-6(7)8-5/h1-4H |
| InChIKey | KROKLMJQRHYATG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.01 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze CID 59716380 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59716380?
The IUPAC name of CID 59716380 (CID 59716380) is not available.
What is the SMILES notation for CID 59716380?
The canonical SMILES for CID 59716380 is [CH]c1cccc(Br)n1.
What is the InChIKey of CID 59716380?
The InChIKey is KROKLMJQRHYATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN/c1-5-3-2-4-6(7)8-5/h1-4H.
What are the key properties of CID 59716380?
CID 59716380 has a molecular weight of 170.01 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59716380 is sourced from PubChem (CID 59716380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).