C13H20O6 — CID 59716398
2,2,7-trimethyl-4-(2-methyl-1,3-dioxolan-4-yl)-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 59716398) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,2,7-trimethyl-4-(2-methyl-1,3-dioxolan-4-yl)-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | 2,2,7-trimethyl-4-(2-methyl-1,3-dioxolan-4-yl)-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 59716398 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2,2,7-trimethyl-4-(2-methyl-1,3-dioxolan-4-yl)-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | CC1OCC(C2OC(C)(C)OC3C(C)C(=O)OC23)O1 |
| InChI | InChI=1S/C13H20O6/c1-6-9-11(17-12(6)14)10(19-13(3,4)18-9)8-5-15-7(2)16-8/h6-11H,5H2,1-4H3 |
| InChIKey | PQEMTXHYUOTGKQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |