C11H16O4 — CID 59716413
4-ethenyl-2,2,7-trimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 59716413) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-ethenyl-2,2,7-trimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | 4-ethenyl-2,2,7-trimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 59716413 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-ethenyl-2,2,7-trimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | C=CC1OC(C)(C)OC2C(C)C(=O)OC12 |
| InChI | InChI=1S/C11H16O4/c1-5-7-9-8(6(2)10(12)13-9)15-11(3,4)14-7/h5-9H,1H2,2-4H3 |
| InChIKey | MBSHNNIFUCKUGD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|