C24H15Cl2N7O2 — CID 59716853
7,8-bis(4-chlorophenyl)-2-[(3-oxo-2H-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 59716853) has the molecular formula C24H15Cl2N7O2 and a molecular weight of 504.34 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-2-[(3-oxo-2H-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 7,8-bis(4-chlorophenyl)-2-[(3-oxo-2H-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 59716853 |
| Molecular Formula | C24H15Cl2N7O2 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-2-[(3-oxo-2H-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2cc(Cn3nc4c(-c5ccc(Cl)cc5)c(-c5ccc(Cl)cc5)cnn4c3=O)ccn12 |
| InChI | InChI=1S/C24H15Cl2N7O2/c25-17-5-1-15(2-6-17)19-12-27-33-22(21(19)16-3-7-18(26)8-4-16)30-32(24(33)35)13-14-9-10-31-20(11-14)28-29-23(31)34/h1-12H,13H2,(H,29,34) |
| InChIKey | LIJLZFOQHOAKHV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |