C16H13FIN3O4 — CID 59717046
1-(2-fluoro-4-iodophenyl)-5-hydroxy-3,6,8-trimethylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59717046) has the molecular formula C16H13FIN3O4 and a molecular weight of 457.20 g/mol. Its IUPAC name is 1-(2-fluoro-4-iodophenyl)-5-hydroxy-3,6,8-trimethylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-(2-fluoro-4-iodophenyl)-5-hydroxy-3,6,8-trimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59717046 |
| Molecular Formula | C16H13FIN3O4 |
| Molecular Weight | 457.20 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | 1-(2-fluoro-4-iodophenyl)-5-hydroxy-3,6,8-trimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1c(O)c2c(=O)n(C)c(=O)n(-c3ccc(I)cc3F)c2n(C)c1=O |
| InChI | InChI=1S/C16H13FIN3O4/c1-7-12(22)11-13(19(2)14(7)23)21(16(25)20(3)15(11)24)10-5-4-8(18)6-9(10)17/h4-6,22H,1-3H3 |
| InChIKey | MDHHRDBYFXHCAL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|