C25H20N4O3 — CID 59717155
3-cyclopropyl-5-(4-ethynylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59717155) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-cyclopropyl-5-(4-ethynylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-5-(4-ethynylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59717155 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 3-cyclopropyl-5-(4-ethynylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | C#Cc1ccc(Nc2cc(=O)n(C)c3c2c(=O)n(C2CC2)c(=O)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N4O3/c1-3-16-9-11-17(12-10-16)26-20-15-21(30)27(2)23-22(20)24(31)29(19-13-14-19)25(32)28(23)18-7-5-4-6-8-18/h1,4-12,15,19,26H,13-14H2,2H3 |
| InChIKey | JLOYYLJHJCWKSH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|