C25H25N4O4P — CID 59717479
3-cyclopropyl-5-(4-dimethylphosphorylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59717479) has the molecular formula C25H25N4O4P and a molecular weight of 476.47 g/mol. Its IUPAC name is 3-cyclopropyl-5-(4-dimethylphosphorylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-5-(4-dimethylphosphorylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59717479 |
| Molecular Formula | C25H25N4O4P |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-cyclopropyl-5-(4-dimethylphosphorylanilino)-8-methyl-1-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)cc(Nc2ccc(P(C)(C)=O)cc2)c2c(=O)n(C3CC3)c(=O)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C25H25N4O4P/c1-27-21(30)15-20(26-16-9-13-19(14-10-16)34(2,3)33)22-23(27)28(17-7-5-4-6-8-17)25(32)29(24(22)31)18-11-12-18/h4-10,13-15,18,26H,11-12H2,1-3H3 |
| InChIKey | ZXLZWWJTTXYIRC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|