C34H46N2O8S2 — CID 59717807
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[[3-(butylsulfanylmethyl)-1-benzofuran-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59717807) has the molecular formula C34H46N2O8S2 and a molecular weight of 674.88 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[[3-(butylsulfanylmethyl)-1-benzofuran-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[[3-(butylsulfanylmethyl)-1-benzofuran-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59717807 |
| Molecular Formula | C34H46N2O8S2 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[[3-(butylsulfanylmethyl)-1-benzofuran-5-yl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCSCc1coc2ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)OC3COC4OCCC34)cc12 |
| InChI | InChI=1S/C34H46N2O8S2/c1-4-5-15-45-22-25-20-42-31-12-11-26(17-28(25)31)46(39,40)36(18-23(2)3)19-30(37)29(16-24-9-7-6-8-10-24)35-34(38)44-32-21-43-33-27(32)13-14-41-33/h6-12,17,20,23,27,29-30,32-33,37H,4-5,13-16,18-19,21-22H2,1-3H3,(H,35,38)/t27?,29-,30+,32?,33?/m0/s1 |
| InChIKey | DKKXDWVPUPEQRL-RBKNPXTCSA-N |
| XLogP | 5.57 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|