C52H56F2N2O2S2 — CID 59718117
5-[5-(2,5-difluoro-4-methylphenyl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)quinoxaline (PubChem CID 59718117) has the molecular formula C52H56F2N2O2S2 and a molecular weight of 843.16 g/mol. Its IUPAC name is 5-[5-(2,5-difluoro-4-methylphenyl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)quinoxaline.
| Compound Name | 5-[5-(2,5-difluoro-4-methylphenyl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)quinoxaline |
|---|---|
| PubChem CID | 59718117 |
| Molecular Formula | C52H56F2N2O2S2 |
| Molecular Weight | 843.16 g/mol |
| Exact Mass | 842.38 |
| IUPAC Name | 5-[5-(2,5-difluoro-4-methylphenyl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)quinoxaline |
| SMILES | CCCCCCCCOc1ccc(-c2nc3c(-c4ccc(C)s4)ccc(-c4ccc(-c5cc(F)c(C)cc5F)s4)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C52H56F2N2O2S2/c1-5-7-9-11-13-15-31-57-39-22-18-37(19-23-39)49-50(38-20-24-40(25-21-38)58-32-16-14-12-10-8-6-2)56-52-42(27-26-41(51(52)55-49)46-28-17-36(4)59-46)47-29-30-48(60-47)43-34-44(53)35(3)33-45(43)54/h17-30,33-34H,5-16,31-32H2,1-4H3 |
| InChIKey | ACULXRHMRXNJNA-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.16 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|