C60H72F2N2O2S2 — CID 59718120
5-[5-(2,5-difluoro-4-methylphenyl)-4-hexylthiophen-2-yl]-2,3-bis(4-hexoxyphenyl)-8-(4-hexyl-5-methylthiophen-2-yl)quinoxaline (PubChem CID 59718120) has the molecular formula C60H72F2N2O2S2 and a molecular weight of 955.38 g/mol. Its IUPAC name is 5-[5-(2,5-difluoro-4-methylphenyl)-4-hexylthiophen-2-yl]-2,3-bis(4-hexoxyphenyl)-8-(4-hexyl-5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 5-[5-(2,5-difluoro-4-methylphenyl)-4-hexylthiophen-2-yl]-2,3-bis(4-hexoxyphenyl)-8-(4-hexyl-5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 59718120 |
| Molecular Formula | C60H72F2N2O2S2 |
| Molecular Weight | 955.38 g/mol |
| Exact Mass | 954.50 |
| IUPAC Name | 5-[5-(2,5-difluoro-4-methylphenyl)-4-hexylthiophen-2-yl]-2,3-bis(4-hexoxyphenyl)-8-(4-hexyl-5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCCCOc1ccc(-c2nc3c(-c4cc(CCCCCC)c(C)s4)ccc(-c4cc(CCCCCC)c(-c5cc(F)c(C)cc5F)s4)c3nc2-c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C60H72F2N2O2S2/c1-7-11-15-19-23-45-38-54(67-42(45)6)49-33-34-50(55-39-46(24-20-16-12-8-2)60(68-55)51-40-52(61)41(5)37-53(51)62)59-58(49)63-56(43-25-29-47(30-26-43)65-35-21-17-13-9-3)57(64-59)44-27-31-48(32-28-44)66-36-22-18-14-10-4/h25-34,37-40H,7-24,35-36H2,1-6H3 |
| InChIKey | KKLSVQZYENLDGC-UHFFFAOYSA-N |
| XLogP | 19.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.38 |
| LogP ≤ 5 | 19.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|