C52H54F4N2O2S2 — CID 59718128
5-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)-8-[5-(2,3,5,6-tetrafluoro-4-methylphenyl)thiophen-2-yl]quinoxaline (PubChem CID 59718128) has the molecular formula C52H54F4N2O2S2 and a molecular weight of 879.14 g/mol. Its IUPAC name is 5-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)-8-[5-(2,3,5,6-tetrafluoro-4-methylphenyl)thiophen-2-yl]quinoxaline.
| Compound Name | 5-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)-8-[5-(2,3,5,6-tetrafluoro-4-methylphenyl)thiophen-2-yl]quinoxaline |
|---|---|
| PubChem CID | 59718128 |
| Molecular Formula | C52H54F4N2O2S2 |
| Molecular Weight | 879.14 g/mol |
| Exact Mass | 878.36 |
| IUPAC Name | 5-(5-methylthiophen-2-yl)-2,3-bis(4-octoxyphenyl)-8-[5-(2,3,5,6-tetrafluoro-4-methylphenyl)thiophen-2-yl]quinoxaline |
| SMILES | CCCCCCCCOc1ccc(-c2nc3c(-c4ccc(C)s4)ccc(-c4ccc(-c5c(F)c(F)c(C)c(F)c5F)s4)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C52H54F4N2O2S2/c1-5-7-9-11-13-15-31-59-37-22-18-35(19-23-37)49-50(36-20-24-38(25-21-36)60-32-16-14-12-10-8-6-2)58-52-40(27-26-39(51(52)57-49)41-28-17-33(3)61-41)42-29-30-43(62-42)44-47(55)45(53)34(4)46(54)48(44)56/h17-30H,5-16,31-32H2,1-4H3 |
| InChIKey | KNFNDQCDKDHGMR-UHFFFAOYSA-N |
| XLogP | 16.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.14 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|