C42H36S3 — CID 59718202
2,5-bis[4-(3,4-dimethyl-5-phenylthiophen-2-yl)phenyl]-3,4-dimethylthiophene (PubChem CID 59718202) has the molecular formula C42H36S3 and a molecular weight of 636.95 g/mol. Its IUPAC name is 2,5-bis[4-(3,4-dimethyl-5-phenylthiophen-2-yl)phenyl]-3,4-dimethylthiophene.
| Compound Name | 2,5-bis[4-(3,4-dimethyl-5-phenylthiophen-2-yl)phenyl]-3,4-dimethylthiophene |
|---|---|
| PubChem CID | 59718202 |
| Molecular Formula | C42H36S3 |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 2,5-bis[4-(3,4-dimethyl-5-phenylthiophen-2-yl)phenyl]-3,4-dimethylthiophene |
| SMILES | Cc1c(-c2ccccc2)sc(-c2ccc(-c3sc(-c4ccc(-c5sc(-c6ccccc6)c(C)c5C)cc4)c(C)c3C)cc2)c1C |
| InChI | InChI=1S/C42H36S3/c1-25-27(3)39(43-37(25)31-13-9-7-10-14-31)33-17-21-35(22-18-33)41-29(5)30(6)42(45-41)36-23-19-34(20-24-36)40-28(4)26(2)38(44-40)32-15-11-8-12-16-32/h7-24H,1-6H3 |
| InChIKey | SKKMRSGUJWUTPD-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |