C11H17F2N5O — CID 59718465
N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide (PubChem CID 59718465) has the molecular formula C11H17F2N5O and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide.
| Compound Name | N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide |
|---|---|
| PubChem CID | 59718465 |
| Molecular Formula | C11H17F2N5O |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide |
| SMILES | CC(=O)NCCCCCCNc1nc(F)nc(F)n1 |
| InChI | InChI=1S/C11H17F2N5O/c1-8(19)14-6-4-2-3-5-7-15-11-17-9(12)16-10(13)18-11/h2-7H2,1H3,(H,14,19)(H,15,16,17,18) |
| InChIKey | UVWOJLHFHQSQTH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|