C20H25N5O2 — CID 59718630
(9R,10R)-10-[4-(5-amino-3-pyridinyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 59718630) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (9R,10R)-10-[4-(5-amino-3-pyridinyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-10-[4-(5-amino-3-pyridinyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 59718630 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (9R,10R)-10-[4-(5-amino-3-pyridinyl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | CC(CCc1cncc(N)c1)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C20H25N5O2/c1-12(5-6-13-9-14(21)11-22-10-13)23-17-7-8-25-18-15(19(17)26)3-2-4-16(18)24-20(25)27/h2-4,9-12,17,19,23,26H,5-8,21H2,1H3,(H,24,27)/t12?,17-,19-/m1/s1 |
| InChIKey | DMKZVHSVOBQINR-RHABNTCASA-N |
| XLogP | 1.72 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |