C21H23F2NO3 — CID 59718735
ethyl 1-[(2,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxylate (PubChem CID 59718735) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 1-[(2,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxylate.
| Compound Name | ethyl 1-[(2,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59718735 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl 1-[(2,4-difluorophenyl)methyl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n(Cc3ccc(F)cc3F)c1=O)CCCCCC2 |
| InChI | InChI=1S/C21H23F2NO3/c1-2-27-21(26)17-11-14-7-5-3-4-6-8-19(14)24(20(17)25)13-15-9-10-16(22)12-18(15)23/h9-12H,2-8,13H2,1H3 |
| InChIKey | SNNLTKLEOQZWSV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |