C28H42N2O5 — CID 59718768
ethyl 2-[[1-(cyclohexylmethyl)-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 59718768) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is ethyl 2-[[1-(cyclohexylmethyl)-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[[1-(cyclohexylmethyl)-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59718768 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | ethyl 2-[[1-(cyclohexylmethyl)-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1NC(=O)c1c(O)c2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C28H42N2O5/c1-2-35-28(34)20-14-10-11-16-22(20)29-26(32)24-25(31)21-15-8-3-4-9-17-23(21)30(27(24)33)18-19-12-6-5-7-13-19/h19-20,22,31H,2-18H2,1H3,(H,29,32) |
| InChIKey | AADPDKSJABOEFX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |