C27H43N3O4 — CID 59718871
2-(dimethylamino)ethyl 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoate (PubChem CID 59718871) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoate.
| Compound Name | 2-(dimethylamino)ethyl 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 59718871 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoate |
| SMILES | CN(C)CCOC(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C27H43N3O4/c1-27(2,26(33)34-17-16-29(3)4)28-24(31)22-18-21-14-10-5-6-11-15-23(21)30(25(22)32)19-20-12-8-7-9-13-20/h18,20H,5-17,19H2,1-4H3,(H,28,31) |
| InChIKey | YJXVEJXXFIYAKW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |