C22H35ClN10O — CID 59718974
3,5-diamino-6-chloro-N-[1-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butylamino]ethenyl]pyrazine-2-carboxamide (PubChem CID 59718974) has the molecular formula C22H35ClN10O and a molecular weight of 491.04 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[1-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butylamino]ethenyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[1-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butylamino]ethenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59718974 |
| Molecular Formula | C22H35ClN10O |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[1-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butylamino]ethenyl]pyrazine-2-carboxamide |
| SMILES | C=C(NCCCCN1CCN(CCCCc2ncc[nH]2)CC1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C22H35ClN10O/c1-16(29-22(34)18-20(24)31-21(25)19(23)30-18)26-7-3-5-11-33-14-12-32(13-15-33)10-4-2-6-17-27-8-9-28-17/h8-9,26H,1-7,10-15H2,(H,27,28)(H,29,34)(H4,24,25,31) |
| InChIKey | YKWHHJRLMJQRJU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|