About 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one
7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one (PubChem CID 59719020) has the molecular formula C13H16BrNO2
and a molecular weight of 300.19 g/mol. Its IUPAC name is 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one |
| PubChem CID | 59719020 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one |
| SMILES | [2H]C1([2H])CC(=O)Nc2cc(OCCCCBr)ccc21 |
| InChI | InChI=1S/C13H16BrNO2/c14-7-1-2-8-17-11-5-3-10-4-6-13(16)15-12(10)9-11/h3,5,9H,1-2,4,6-8H2,(H,15,16)/i4D2 |
| InChIKey | URHLNHVYMNBPEO-APZFVMQVSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one?
The IUPAC name of 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one (CID 59719020) is 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one.
What is the SMILES notation for 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one?
The canonical SMILES for 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one is [2H]C1([2H])CC(=O)Nc2cc(OCCCCBr)ccc21.
What is the InChIKey of 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one?
The InChIKey is URHLNHVYMNBPEO-APZFVMQVSA-N. The full InChI is InChI=1S/C13H16BrNO2/c14-7-1-2-8-17-11-5-3-10-4-6-13(16)15-12(10)9-11/h3,5,9H,1-2,4,6-8H2,(H,15,16)/i4D2.
What are the key properties of 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one?
7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one has a molecular weight of 300.19 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-bromobutoxy)-4,4-dideuterio-1,3-dihydroquinolin-2-one is sourced from PubChem (CID 59719020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).