C14H21N3O2S — CID 59719242
1-[3-[2-[bis(trideuteriomethyl)amino]-1,1-dideuterioethyl]-1,2,4,6,7-pentadeuterioindol-5-yl]-N-deuterio-N-(trideuteriomethyl)methanesulfonamide (PubChem CID 59719242) has the molecular formula C14H21N3O2S and a molecular weight of 312.51 g/mol. Its IUPAC name is 1-[3-[2-[bis(trideuteriomethyl)amino]-1,1-dideuterioethyl]-1,2,4,6,7-pentadeuterioindol-5-yl]-N-deuterio-N-(trideuteriomethyl)methanesulfonamide.
| Compound Name | 1-[3-[2-[bis(trideuteriomethyl)amino]-1,1-dideuterioethyl]-1,2,4,6,7-pentadeuterioindol-5-yl]-N-deuterio-N-(trideuteriomethyl)methanesulfonamide |
|---|---|
| PubChem CID | 59719242 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 1-[3-[2-[bis(trideuteriomethyl)amino]-1,1-dideuterioethyl]-1,2,4,6,7-pentadeuterioindol-5-yl]-N-deuterio-N-(trideuteriomethyl)methanesulfonamide |
| SMILES | [2H]c1c(CS(=O)(=O)N([2H])C([2H])([2H])[2H])c([2H])c2c(C([2H])([2H])CN(C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])n([2H])c2c1[2H] |
| InChI | InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3/i1D3,2D3,3D3,4D,5D,6D2,8D,9D/hD2 |
| InChIKey | KQKPFRSPSRPDEB-YHJDGUPISA-N |
| XLogP | 1.32 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |