C16H21N3O2 — CID 59719635
(4S)-3,5,5-trideuterio-4-[dideuterio-[1,2-dideuterio-3-[1,1-dideuterio-2-(dimethylamino)ethyl]indol-5-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 59719635) has the molecular formula C16H21N3O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is (4S)-3,5,5-trideuterio-4-[dideuterio-[1,2-dideuterio-3-[1,1-dideuterio-2-(dimethylamino)ethyl]indol-5-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3,5,5-trideuterio-4-[dideuterio-[1,2-dideuterio-3-[1,1-dideuterio-2-(dimethylamino)ethyl]indol-5-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59719635 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (4S)-3,5,5-trideuterio-4-[dideuterio-[1,2-dideuterio-3-[1,1-dideuterio-2-(dimethylamino)ethyl]indol-5-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | [2H]c1c(C([2H])([2H])CN(C)C)c2cc(C([2H])([2H])[C@@H]3N([2H])C(=O)OC3([2H])[2H])ccc2n1[2H] |
| InChI | InChI=1S/C16H21N3O2/c1-19(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-21-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20)/t13-/m0/s1/i5D2,7D2,9D,10D2/hD2 |
| InChIKey | ULSDMUVEXKOYBU-MJQMZTLKSA-N |
| XLogP | 1.92 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |