C14H21N3O2S — CID 59720104
1,1-dideuterio-N-methyl-1-[4,6,7-trideuterio-3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide (PubChem CID 59720104) has the molecular formula C14H21N3O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is 1,1-dideuterio-N-methyl-1-[4,6,7-trideuterio-3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide.
| Compound Name | 1,1-dideuterio-N-methyl-1-[4,6,7-trideuterio-3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 59720104 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1,1-dideuterio-N-methyl-1-[4,6,7-trideuterio-3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide |
| SMILES | [2H]c1c(C([2H])([2H])S(=O)(=O)NC)c([2H])c2c(C([2H])([2H])C([2H])([2H])N(C)C)c[nH]c2c1[2H] |
| InChI | InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3/i4D,5D,6D2,7D2,8D,10D2 |
| InChIKey | KQKPFRSPSRPDEB-LDZBNGSISA-N |
| XLogP | 1.32 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |