C15H24 — CID 59720392
(4aR,10aS)-4a-methyl-2,3,4,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene (PubChem CID 59720392) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (4aR,10aS)-4a-methyl-2,3,4,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene.
| Compound Name | (4aR,10aS)-4a-methyl-2,3,4,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 59720392 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4aR,10aS)-4a-methyl-2,3,4,6,7,8,8a,9,10,10a-decahydro-1H-phenanthrene |
| SMILES | C[C@@]12CCCC[C@H]1CCC1CCCC=C12 |
| InChI | InChI=1S/C15H24/c1-15-11-5-4-7-13(15)10-9-12-6-2-3-8-14(12)15/h8,12-13H,2-7,9-11H2,1H3/t12?,13-,15+/m0/s1 |
| InChIKey | MYPPZZRRCFWPNQ-RGPPAHDHSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|