C17H22F6 — CID 59720881
5-[1,1,1,3,3,3-hexafluoro-2-(3-methylcyclohex-3-en-1-yl)propan-2-yl]-1-methylcyclohexene (PubChem CID 59720881) has the molecular formula C17H22F6 and a molecular weight of 340.35 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(3-methylcyclohex-3-en-1-yl)propan-2-yl]-1-methylcyclohexene.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(3-methylcyclohex-3-en-1-yl)propan-2-yl]-1-methylcyclohexene |
|---|---|
| PubChem CID | 59720881 |
| Molecular Formula | C17H22F6 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(3-methylcyclohex-3-en-1-yl)propan-2-yl]-1-methylcyclohexene |
| SMILES | CC1=CCCC(C(C2CCC=C(C)C2)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H22F6/c1-11-5-3-7-13(9-11)15(16(18,19)20,17(21,22)23)14-8-4-6-12(2)10-14/h5-6,13-14H,3-4,7-10H2,1-2H3 |
| InChIKey | SEBMZEQELKMOSN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|