C31H45N6O11P — CID 59720966
3-[2-(butoxymethyl)heptoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate (PubChem CID 59720966) has the molecular formula C31H45N6O11P and a molecular weight of 708.71 g/mol. Its IUPAC name is 3-[2-(butoxymethyl)heptoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate.
| Compound Name | 3-[2-(butoxymethyl)heptoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 59720966 |
| Molecular Formula | C31H45N6O11P |
| Molecular Weight | 708.71 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | 3-[2-(butoxymethyl)heptoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
| SMILES | CCCCCC(COCCCC)COP(=O)(CCCOC(=O)NCCCNc1ccc([N+](=O)[O-])c2nonc12)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H45N6O11P/c1-3-5-7-10-24(22-44-19-6-4-2)23-46-49(43,47-26-13-11-25(12-14-26)36(39)40)21-9-20-45-31(38)33-18-8-17-32-27-15-16-28(37(41)42)30-29(27)34-48-35-30/h11-16,24,32H,3-10,17-23H2,1-2H3,(H,33,38) |
| InChIKey | PZYZOGIFGDULMH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 220.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|