C21H25N6O10P — CID 59720968
3-[ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate (PubChem CID 59720968) has the molecular formula C21H25N6O10P and a molecular weight of 552.44 g/mol. Its IUPAC name is 3-[ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate.
| Compound Name | 3-[ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 59720968 |
| Molecular Formula | C21H25N6O10P |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 3-[ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
| SMILES | CCOP(=O)(CCCOC(=O)NCCCNc1ccc([N+](=O)[O-])c2nonc12)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25N6O10P/c1-2-35-38(33,36-16-7-5-15(6-8-16)26(29)30)14-4-13-34-21(28)23-12-3-11-22-17-9-10-18(27(31)32)20-19(17)24-37-25-20/h5-10,22H,2-4,11-14H2,1H3,(H,23,28) |
| InChIKey | GOBPALJLQJDUKU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 211.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|