C26H33N6O12P — CID 59720972
3-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate (PubChem CID 59720972) has the molecular formula C26H33N6O12P and a molecular weight of 652.55 g/mol. Its IUPAC name is 3-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate.
| Compound Name | 3-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 59720972 |
| Molecular Formula | C26H33N6O12P |
| Molecular Weight | 652.55 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | 3-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy-(4-nitrophenoxy)phosphoryl]propyl N-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propyl]carbamate |
| SMILES | CC1(C)OC[C@H](CCOP(=O)(CCCOC(=O)NCCCNc2ccc([N+](=O)[O-])c3nonc23)Oc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C26H33N6O12P/c1-26(2)40-17-20(42-26)11-15-41-45(38,43-19-7-5-18(6-8-19)31(34)35)16-4-14-39-25(33)28-13-3-12-27-21-9-10-22(32(36)37)24-23(21)29-44-30-24/h5-10,20,27H,3-4,11-17H2,1-2H3,(H,28,33)/t20-,45?/m0/s1 |
| InChIKey | HFEIAVXKQLKWCO-WKFWHPHNSA-N |
| XLogP | 4.79 |
| TPSA | 229.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|