C13H22O5S2 — CID 59721074
(2R,8S,9R)-4,4,11,11-tetramethyl-8-[(methyldisulfanyl)methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 59721074) has the molecular formula C13H22O5S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2R,8S,9R)-4,4,11,11-tetramethyl-8-[(methyldisulfanyl)methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (2R,8S,9R)-4,4,11,11-tetramethyl-8-[(methyldisulfanyl)methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 59721074 |
| Molecular Formula | C13H22O5S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (2R,8S,9R)-4,4,11,11-tetramethyl-8-[(methyldisulfanyl)methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CSSC[C@H]1OC2OC(C)(C)O[C@@H]2C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H22O5S2/c1-12(2)15-8-7(6-20-19-5)14-11-10(9(8)16-12)17-13(3,4)18-11/h7-11H,6H2,1-5H3/t7-,8+,9?,10-,11?/m1/s1 |
| InChIKey | WSVMGBPRGUSTCW-XJPIPGLHSA-N |
| XLogP | 2.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|