C12H20O5S — CID 59721107
[(2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanethiol (PubChem CID 59721107) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is [(2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanethiol.
| Compound Name | [(2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanethiol |
|---|---|
| PubChem CID | 59721107 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(2R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methanethiol |
| SMILES | CC1(C)OC2O[C@H](CS)[C@@H]3OC(C)(C)OC3[C@H]2O1 |
| InChI | InChI=1S/C12H20O5S/c1-11(2)14-7-6(5-18)13-10-9(8(7)15-11)16-12(3,4)17-10/h6-10,18H,5H2,1-4H3/t6-,7+,8?,9-,10?/m1/s1 |
| InChIKey | AGGBVTQMMNRHMZ-IUPLNGJJSA-N |
| XLogP | 1.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|