C17H19NOS2 — CID 59721165
N,N-dimethyl-1-[(2R,4S,6R)-5-oxa-10,12-dithiatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),7(11),8,13,15-pentaen-4-yl]methanamine (PubChem CID 59721165) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2R,4S,6R)-5-oxa-10,12-dithiatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),7(11),8,13,15-pentaen-4-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2R,4S,6R)-5-oxa-10,12-dithiatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),7(11),8,13,15-pentaen-4-yl]methanamine |
|---|---|
| PubChem CID | 59721165 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N,N-dimethyl-1-[(2R,4S,6R)-5-oxa-10,12-dithiatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),7(11),8,13,15-pentaen-4-yl]methanamine |
| SMILES | CN(C)C[C@@H]1C[C@@H]2c3ccccc3Sc3sccc3[C@@H]2O1 |
| InChI | InChI=1S/C17H19NOS2/c1-18(2)10-11-9-14-12-5-3-4-6-15(12)21-17-13(7-8-20-17)16(14)19-11/h3-8,11,14,16H,9-10H2,1-2H3/t11-,14+,16-/m0/s1 |
| InChIKey | PSNKEVZYDRBOSC-PEYYIBSZSA-N |
| XLogP | 4.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |