C35H44N6O4S2 — CID 59721235
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 59721235) has the molecular formula C35H44N6O4S2 and a molecular weight of 676.91 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59721235 |
| Molecular Formula | C35H44N6O4S2 |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | Cc1nc(CN(C)C(=O)N[C@H](C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)Cc2ccccc2)C(C)C)cs1 |
| InChI | InChI=1S/C35H44N6O4S2/c1-24(2)32(40-34(43)41(4)20-30-22-46-25(3)37-30)33(42)38-28(17-26-11-7-5-8-12-26)15-16-29(18-27-13-9-6-10-14-27)39-35(44)45-21-31-19-36-23-47-31/h5-14,19,22-24,28-29,32H,15-18,20-21H2,1-4H3,(H,38,42)(H,39,44)(H,40,43)/t28-,29-,32+/m1/s1 |
| InChIKey | IDZMIOJJLGAUFK-PUCLRWMGSA-N |
| XLogP | 6.12 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |