C37H49N7O4S2 — CID 59721348
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-(methylamino)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 59721348) has the molecular formula C37H49N7O4S2 and a molecular weight of 719.98 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-(methylamino)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-(methylamino)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59721348 |
| Molecular Formula | C37H49N7O4S2 |
| Molecular Weight | 719.98 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-(methylamino)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CNCC[C@H](NC(=O)N(C)Cc1csc(C(C)C)n1)C(=O)N[C@H](CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C37H49N7O4S2/c1-26(2)35-41-31(24-49-35)22-44(4)36(46)43-33(17-18-38-3)34(45)40-29(19-27-11-7-5-8-12-27)15-16-30(20-28-13-9-6-10-14-28)42-37(47)48-23-32-21-39-25-50-32/h5-14,21,24-26,29-30,33,38H,15-20,22-23H2,1-4H3,(H,40,45)(H,42,47)(H,43,46)/t29-,30-,33+/m1/s1 |
| InChIKey | VFJGSZLCNCKFER-QSCLJHCWSA-N |
| XLogP | 5.89 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |