C34H42N6O4S2 — CID 59721361
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 59721361) has the molecular formula C34H42N6O4S2 and a molecular weight of 662.88 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59721361 |
| Molecular Formula | C34H42N6O4S2 |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-3-methyl-2-[[methyl(1,3-thiazol-4-ylmethyl)carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)N(C)Cc1cscn1)C(=O)N[C@H](CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C34H42N6O4S2/c1-24(2)31(39-33(42)40(3)19-29-21-45-23-36-29)32(41)37-27(16-25-10-6-4-7-11-25)14-15-28(17-26-12-8-5-9-13-26)38-34(43)44-20-30-18-35-22-46-30/h4-13,18,21-24,27-28,31H,14-17,19-20H2,1-3H3,(H,37,41)(H,38,43)(H,39,42)/t27-,28-,31+/m1/s1 |
| InChIKey | RXXJTASWFDWOMQ-WUNLWTINSA-N |
| XLogP | 5.81 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |