About (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol
(2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol (PubChem CID 59721596) has the molecular formula C8H12F2O
and a molecular weight of 162.18 g/mol. Its IUPAC name is (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol |
| PubChem CID | 59721596 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol |
| SMILES | C=CC1C(C[C@H](C)O)C1(F)F |
| InChI | InChI=1S/C8H12F2O/c1-3-6-7(4-5(2)11)8(6,9)10/h3,5-7,11H,1,4H2,2H3/t5-,6?,7?/m0/s1 |
| InChIKey | GSKGRVIQOJOUPP-VTSJMVTISA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol?
The IUPAC name of (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol (CID 59721596) is (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol.
What is the SMILES notation for (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol?
The canonical SMILES for (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol is C=CC1C(C[C@H](C)O)C1(F)F.
What is the InChIKey of (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol?
The InChIKey is GSKGRVIQOJOUPP-VTSJMVTISA-N. The full InChI is InChI=1S/C8H12F2O/c1-3-6-7(4-5(2)11)8(6,9)10/h3,5-7,11H,1,4H2,2H3/t5-,6?,7?/m0/s1.
What are the key properties of (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol?
(2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol has a molecular weight of 162.18 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3-ethenyl-2,2-difluorocyclopropyl)propan-2-ol is sourced from PubChem (CID 59721596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).