C22H36O3Si — CID 59721600
hex-5-enyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxydeca-6,8-dien-2-ynoate (PubChem CID 59721600) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is hex-5-enyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxydeca-6,8-dien-2-ynoate.
| Compound Name | hex-5-enyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxydeca-6,8-dien-2-ynoate |
|---|---|
| PubChem CID | 59721600 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | hex-5-enyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxydeca-6,8-dien-2-ynoate |
| SMILES | C=CCCCCOC(=O)C#CCC(/C=C/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O3Si/c1-8-10-12-14-19-24-21(23)18-15-17-20(16-13-11-9-2)25-26(6,7)22(3,4)5/h8-9,11,13,16,20H,1,10,12,14,17,19H2,2-7H3/b11-9+,16-13+ |
| InChIKey | HKHGGTWIKVFPHE-BNUVGFPPSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|