C17H10O7 — CID 59721644
5-(1,3-dioxo-3a,7a-dihydro-2-benzofuran-5-carbonyl)-3a,7a-dihydro-2-benzofuran-1,3-dione (PubChem CID 59721644) has the molecular formula C17H10O7 and a molecular weight of 326.26 g/mol. Its IUPAC name is 5-(1,3-dioxo-3a,7a-dihydro-2-benzofuran-5-carbonyl)-3a,7a-dihydro-2-benzofuran-1,3-dione.
| Compound Name | 5-(1,3-dioxo-3a,7a-dihydro-2-benzofuran-5-carbonyl)-3a,7a-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 59721644 |
| Molecular Formula | C17H10O7 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-(1,3-dioxo-3a,7a-dihydro-2-benzofuran-5-carbonyl)-3a,7a-dihydro-2-benzofuran-1,3-dione |
| SMILES | O=C(C1=CC2C(=O)OC(=O)C2C=C1)C1=CC2C(=O)OC(=O)C2C=C1 |
| InChI | InChI=1S/C17H10O7/c18-13(7-1-3-9-11(5-7)16(21)23-14(9)19)8-2-4-10-12(6-8)17(22)24-15(10)20/h1-6,9-12H |
| InChIKey | GPZURBCDXSPOMC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|