C11H12F12S — CID 59721671
8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octane-1-thiol (PubChem CID 59721671) has the molecular formula C11H12F12S and a molecular weight of 404.26 g/mol. Its IUPAC name is 8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octane-1-thiol.
| Compound Name | 8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 59721671 |
| Molecular Formula | C11H12F12S |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octane-1-thiol |
| SMILES | FC(F)(F)C(CCCCS)CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F12S/c12-8(13,14)6(3-1-2-4-24)5-7(9(15,16)17,10(18,19)20)11(21,22)23/h6,24H,1-5H2 |
| InChIKey | FIJSIWUQBYAUMJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|