C16H12F20 — CID 59721677
(Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-4,6,12-tris(trifluoromethyl)tridec-2-ene (PubChem CID 59721677) has the molecular formula C16H12F20 and a molecular weight of 584.23 g/mol. Its IUPAC name is (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-4,6,12-tris(trifluoromethyl)tridec-2-ene.
| Compound Name | (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-4,6,12-tris(trifluoromethyl)tridec-2-ene |
|---|---|
| PubChem CID | 59721677 |
| Molecular Formula | C16H12F20 |
| Molecular Weight | 584.23 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-4,6,12-tris(trifluoromethyl)tridec-2-ene |
| SMILES | FC(F)(F)/C=C\C(CC(CC(F)(F)CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H12F20/c17-9(18,5-10(19,20)6-11(21,15(31,32)33)16(34,35)36)4-8(14(28,29)30)3-7(13(25,26)27)1-2-12(22,23)24/h1-2,7-8H,3-6H2/b2-1- |
| InChIKey | BBZAWYYRKFFDMR-UPHRSURJSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.23 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|