C16H30N2O3 — CID 59721806
ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,5-dimethylhex-2-enoate (PubChem CID 59721806) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 59721806 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](NC(=O)[C@@H](N)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-8-21-15(20)11(4)9-12(10(2)3)18-14(19)13(17)16(5,6)7/h9-10,12-13H,8,17H2,1-7H3,(H,18,19)/b11-9+/t12-,13-/m1/s1 |
| InChIKey | XNFGPIXBZZSDCT-FWPSRMAWSA-N |
| XLogP | 2.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|