C40H35ClN3NiO3+ — CID 59721840
(1-benzylpyrrolidine-2-carbonyl)-[2-[N-(1-carboxy-2,2-diphenylethyl)-C-phenylcarbonimidoyl]-4-chlorophenyl]azanide;nickel(2+) (PubChem CID 59721840) has the molecular formula C40H35ClN3NiO3+ and a molecular weight of 699.88 g/mol. Its IUPAC name is (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(1-carboxy-2,2-diphenylethyl)-C-phenylcarbonimidoyl]-4-chlorophenyl]azanide;nickel(2+).
| Compound Name | (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(1-carboxy-2,2-diphenylethyl)-C-phenylcarbonimidoyl]-4-chlorophenyl]azanide;nickel(2+) |
|---|---|
| PubChem CID | 59721840 |
| Molecular Formula | C40H35ClN3NiO3+ |
| Molecular Weight | 699.88 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | (1-benzylpyrrolidine-2-carbonyl)-[2-[N-(1-carboxy-2,2-diphenylethyl)-C-phenylcarbonimidoyl]-4-chlorophenyl]azanide;nickel(2+) |
| SMILES | O=C(O)C(/N=C(\c1ccccc1)c1cc(Cl)ccc1[N-]C(=O)C1CCCN1Cc1ccccc1)C(c1ccccc1)c1ccccc1.[Ni+2] |
| InChI | InChI=1S/C40H36ClN3O3.Ni/c41-32-23-24-34(42-39(45)35-22-13-25-44(35)27-28-14-5-1-6-15-28)33(26-32)37(31-20-11-4-12-21-31)43-38(40(46)47)36(29-16-7-2-8-17-29)30-18-9-3-10-19-30;/h1-12,14-21,23-24,26,35-36,38H,13,22,25,27H2,(H2,42,43,45,46,47);/q;+2/p-1 |
| InChIKey | WNVASSJQDRRZEE-UHFFFAOYSA-M |
| XLogP | 8.66 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|