C24H22N2O3S2 — CID 59721932
(5Z)-3-(1-hydroperoxyethenyl)-5-[(E)-3-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 59721932) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is (5Z)-3-(1-hydroperoxyethenyl)-5-[(E)-3-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1-hydroperoxyethenyl)-5-[(E)-3-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 59721932 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (5Z)-3-(1-hydroperoxyethenyl)-5-[(E)-3-[1-(4-methylphenyl)-3,4-dihydro-2H-quinolin-6-yl]prop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=C(OO)N1C(=O)/C(=C/C=C/c2ccc3c(c2)CCCN3c2ccc(C)cc2)SC1=S |
| InChI | InChI=1S/C24H22N2O3S2/c1-16-8-11-20(12-9-16)25-14-4-6-19-15-18(10-13-21(19)25)5-3-7-22-23(27)26(17(2)29-28)24(30)31-22/h3,5,7-13,15,28H,2,4,6,14H2,1H3/b5-3+,22-7- |
| InChIKey | UEMYOQGEYIXWCW-NUYLAVMUSA-N |
| XLogP | 5.80 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|