C70H46N4 — CID 59722090
5-[9,10-diphenyl-6-(2,4,6-triphenylpyrimidin-5-yl)anthracen-2-yl]-2,4,6-triphenylpyrimidine (PubChem CID 59722090) has the molecular formula C70H46N4 and a molecular weight of 943.17 g/mol. Its IUPAC name is 5-[9,10-diphenyl-6-(2,4,6-triphenylpyrimidin-5-yl)anthracen-2-yl]-2,4,6-triphenylpyrimidine.
| Compound Name | 5-[9,10-diphenyl-6-(2,4,6-triphenylpyrimidin-5-yl)anthracen-2-yl]-2,4,6-triphenylpyrimidine |
|---|---|
| PubChem CID | 59722090 |
| Molecular Formula | C70H46N4 |
| Molecular Weight | 943.17 g/mol |
| Exact Mass | 942.37 |
| IUPAC Name | 5-[9,10-diphenyl-6-(2,4,6-triphenylpyrimidin-5-yl)anthracen-2-yl]-2,4,6-triphenylpyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c(-c3ccc4c(-c5ccccc5)c5cc(-c6c(-c7ccccc7)nc(-c7ccccc7)nc6-c6ccccc6)ccc5c(-c5ccccc5)c4c3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C70H46N4/c1-9-25-47(26-10-1)61-57-43-41-56(64-67(51-33-17-5-18-34-51)73-70(54-39-23-8-24-40-54)74-68(64)52-35-19-6-20-36-52)46-60(57)62(48-27-11-2-12-28-48)58-44-42-55(45-59(58)61)63-65(49-29-13-3-14-30-49)71-69(53-37-21-7-22-38-53)72-66(63)50-31-15-4-16-32-50/h1-46H |
| InChIKey | APKMFFWCFUAUJZ-UHFFFAOYSA-N |
| XLogP | 18.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.17 |
| LogP ≤ 5 | 18.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|