C34H22N4 — CID 59722147
4-(9,10-diphenyl-6-pyrimidin-4-ylanthracen-2-yl)pyrimidine (PubChem CID 59722147) has the molecular formula C34H22N4 and a molecular weight of 486.58 g/mol. Its IUPAC name is 4-(9,10-diphenyl-6-pyrimidin-4-ylanthracen-2-yl)pyrimidine.
| Compound Name | 4-(9,10-diphenyl-6-pyrimidin-4-ylanthracen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 59722147 |
| Molecular Formula | C34H22N4 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-(9,10-diphenyl-6-pyrimidin-4-ylanthracen-2-yl)pyrimidine |
| SMILES | c1ccc(-c2c3ccc(-c4ccncn4)cc3c(-c3ccccc3)c3ccc(-c4ccncn4)cc23)cc1 |
| InChI | InChI=1S/C34H22N4/c1-3-7-23(8-4-1)33-27-13-11-26(32-16-18-36-22-38-32)20-30(27)34(24-9-5-2-6-10-24)28-14-12-25(19-29(28)33)31-15-17-35-21-37-31/h1-22H |
| InChIKey | OQBWLWQDPTXEER-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|