C82H54N4 — CID 59722233
5-[4-[9,10-diphenyl-6-[4-(2,4,6-triphenylpyrimidin-5-yl)phenyl]anthracen-2-yl]phenyl]-2,4,6-triphenylpyrimidine (PubChem CID 59722233) has the molecular formula C82H54N4 and a molecular weight of 1095.36 g/mol. Its IUPAC name is 5-[4-[9,10-diphenyl-6-[4-(2,4,6-triphenylpyrimidin-5-yl)phenyl]anthracen-2-yl]phenyl]-2,4,6-triphenylpyrimidine.
| Compound Name | 5-[4-[9,10-diphenyl-6-[4-(2,4,6-triphenylpyrimidin-5-yl)phenyl]anthracen-2-yl]phenyl]-2,4,6-triphenylpyrimidine |
|---|---|
| PubChem CID | 59722233 |
| Molecular Formula | C82H54N4 |
| Molecular Weight | 1095.36 g/mol |
| Exact Mass | 1094.43 |
| IUPAC Name | 5-[4-[9,10-diphenyl-6-[4-(2,4,6-triphenylpyrimidin-5-yl)phenyl]anthracen-2-yl]phenyl]-2,4,6-triphenylpyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c(-c3ccc(-c4ccc5c(-c6ccccc6)c6cc(-c7ccc(-c8c(-c9ccccc9)nc(-c9ccccc9)nc8-c8ccccc8)cc7)ccc6c(-c6ccccc6)c5c4)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C82H54N4/c1-9-25-57(26-10-1)73-69-51-49-68(56-43-47-60(48-44-56)76-79(63-33-17-5-18-34-63)85-82(66-39-23-8-24-40-66)86-80(76)64-35-19-6-20-36-64)54-72(69)74(58-27-11-2-12-28-58)70-52-50-67(53-71(70)73)55-41-45-59(46-42-55)75-77(61-29-13-3-14-30-61)83-81(65-37-21-7-22-38-65)84-78(75)62-31-15-4-16-32-62/h1-54H |
| InChIKey | WTRMDRWEVYLASE-UHFFFAOYSA-N |
| XLogP | 21.58 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.36 |
| LogP ≤ 5 | 21.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|