C27H33N5O — CID 59722905
2-[2-[4-(4-pentylcyclohexyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 59722905) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-[2-[4-(4-pentylcyclohexyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-[2-[4-(4-pentylcyclohexyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 59722905 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-[2-[4-(4-pentylcyclohexyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CCCCCC1CCC(c2ccc(-c3nccc(-c4cc5n(n4)CCNC5=O)n3)cc2)CC1 |
| InChI | InChI=1S/C27H33N5O/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)26-28-15-14-23(30-26)24-18-25-27(33)29-16-17-32(25)31-24/h10-15,18-20H,2-9,16-17H2,1H3,(H,29,33) |
| InChIKey | WQOOGNFAAZNOHT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|