C23H17N5O2S — CID 59723113
2-[2-[4-(4-sulfanylbenzoyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 59723113) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-[2-[4-(4-sulfanylbenzoyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-[2-[4-(4-sulfanylbenzoyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 59723113 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[2-[4-(4-sulfanylbenzoyl)phenyl]pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | O=C(c1ccc(S)cc1)c1ccc(-c2nccc(-c3cc4n(n3)CCNC4=O)n2)cc1 |
| InChI | InChI=1S/C23H17N5O2S/c29-21(15-5-7-17(31)8-6-15)14-1-3-16(4-2-14)22-24-10-9-18(26-22)19-13-20-23(30)25-11-12-28(20)27-19/h1-10,13,31H,11-12H2,(H,25,30) |
| InChIKey | ZKGYXKCZNLRIGU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|